C15H17ClO3 — CID 71861239
oxolan-2-ylmethyl 3-(3-chlorophenyl)but-2-enoate (PubChem CID 71861239) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-(3-chlorophenyl)but-2-enoate.
| Compound Name | oxolan-2-ylmethyl 3-(3-chlorophenyl)but-2-enoate |
|---|---|
| PubChem CID | 71861239 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | oxolan-2-ylmethyl 3-(3-chlorophenyl)but-2-enoate |
| SMILES | CC(=CC(=O)OCC1CCCO1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClO3/c1-11(12-4-2-5-13(16)9-12)8-15(17)19-10-14-6-3-7-18-14/h2,4-5,8-9,14H,3,6-7,10H2,1H3 |
| InChIKey | SLWSGTGWICXPPO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|