C23H30NO2+ — CID 124871568
[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-naphthalen-1-ylacetate (PubChem CID 124871568) has the molecular formula C23H30NO2+ and a molecular weight of 352.50 g/mol. Its IUPAC name is [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-naphthalen-1-ylacetate.
| Compound Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 124871568 |
| Molecular Formula | C23H30NO2+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-naphthalen-1-ylacetate |
| SMILES | C[N@+]12CCCC[C@H]1[C@@H](COC(=O)Cc1cccc3ccccc13)CCC2 |
| InChI | InChI=1S/C23H30NO2/c1-24-14-5-4-13-22(24)20(11-7-15-24)17-26-23(25)16-19-10-6-9-18-8-2-3-12-21(18)19/h2-3,6,8-10,12,20,22H,4-5,7,11,13-17H2,1H3/q+1/t20-,22+,24-/m1/s1 |
| InChIKey | FQTGQVXSCBPNGP-JCTONOIOSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|