C20H30NO3+ — CID 3769829
(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-(3-methylphenoxy)acetate (PubChem CID 3769829) has the molecular formula C20H30NO3+ and a molecular weight of 332.46 g/mol. Its IUPAC name is (5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-(3-methylphenoxy)acetate.
| Compound Name | (5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-(3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 3769829 |
| Molecular Formula | C20H30NO3+ |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCC2CCC[N+]3(C)CCCCC23)c1 |
| InChI | InChI=1S/C20H30NO3/c1-16-7-5-9-18(13-16)23-15-20(22)24-14-17-8-6-12-21(2)11-4-3-10-19(17)21/h5,7,9,13,17,19H,3-4,6,8,10-12,14-15H2,1-2H3/q+1 |
| InChIKey | LGLFLWYTGMHRCZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|