C18H26O4 — CID 91408163
ethyl 2-[3-[[2-(hydroxymethyl)cyclohexyl]methyl]phenoxy]acetate (PubChem CID 91408163) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(hydroxymethyl)cyclohexyl]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[2-(hydroxymethyl)cyclohexyl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 91408163 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | ethyl 2-[3-[[2-(hydroxymethyl)cyclohexyl]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(CC2CCCCC2CO)c1 |
| InChI | InChI=1S/C18H26O4/c1-2-21-18(20)13-22-17-9-5-6-14(11-17)10-15-7-3-4-8-16(15)12-19/h5-6,9,11,15-16,19H,2-4,7-8,10,12-13H2,1H3 |
| InChIKey | UTTZQSZUSWUZKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |