C19H25N2O2+ — CID 776178
2-[[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]isoindole-1,3-dione (PubChem CID 776178) has the molecular formula C19H25N2O2+ and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 776178 |
| Molecular Formula | C19H25N2O2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]isoindole-1,3-dione |
| SMILES | C[N@+]12CCCC[C@H]1[C@H](CN1C(=O)c3ccccc3C1=O)CCC2 |
| InChI | InChI=1S/C19H25N2O2/c1-21-11-5-4-10-17(21)14(7-6-12-21)13-20-18(22)15-8-2-3-9-16(15)19(20)23/h2-3,8-9,14,17H,4-7,10-13H2,1H3/q+1/t14-,17-,21+/m0/s1 |
| InChIKey | UMWVQFMDELFMHV-XXHMAFKTSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|