C22H24O9 — CID 135015021
[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2-oxochromene-3-carboxylate (PubChem CID 135015021) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is [(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2-oxochromene-3-carboxylate.
| Compound Name | [(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 135015021 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2-oxochromene-3-carboxylate |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(COC(=O)c3cc4ccccc4oc3=O)O[C@@H]2O1 |
| InChI | InChI=1S/C22H24O9/c1-21(2)28-15-14(27-20-17(16(15)29-21)30-22(3,4)31-20)10-25-18(23)12-9-11-7-5-6-8-13(11)26-19(12)24/h5-9,14-17,20H,10H2,1-4H3/t14?,15-,16?,17?,20+/m0/s1 |
| InChIKey | UCRGETGFVMXDFM-DNRQKVAGSA-N |
| XLogP | 2.35 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|