C21H15NO6 — CID 9290380
[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 9290380) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 9290380 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@H]1C(=O)Nc2ccc(C(=O)COC(=O)c3cc4ccccc4oc3=O)cc21 |
| InChI | InChI=1S/C21H15NO6/c1-11-14-8-12(6-7-16(14)22-19(11)24)17(23)10-27-20(25)15-9-13-4-2-3-5-18(13)28-21(15)26/h2-9,11H,10H2,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | VGXLXEZRKBENFC-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|