C23H25NO5 — CID 9202639
[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 4-pentoxybenzoate (PubChem CID 9202639) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 4-pentoxybenzoate.
| Compound Name | [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 9202639 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)OCC(=O)c2ccc3c(c2)[C@@H](C)C(=O)N3)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-3-4-5-12-28-18-9-6-16(7-10-18)23(27)29-14-21(25)17-8-11-20-19(13-17)15(2)22(26)24-20/h6-11,13,15H,3-5,12,14H2,1-2H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | QLPNMZBDQSNQIL-OAHLLOKOSA-N |
| XLogP | 4.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|