C31H42O14 — CID 101236249
[(2R,3S,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 101236249) has the molecular formula C31H42O14 and a molecular weight of 638.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101236249 |
| Molecular Formula | C31H42O14 |
| Molecular Weight | 638.66 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)[C@H](OCc2ccccc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H42O14/c1-16(32)35-14-20-22(38-17(2)33)24(39-18(3)34)26(36-13-19-11-9-8-10-12-19)28(40-20)37-15-21-23-25(43-30(4,5)42-23)27-29(41-21)45-31(6,7)44-27/h8-12,20-29H,13-15H2,1-7H3/t20-,21-,22+,23+,24+,25+,26-,27-,28+,29-/m1/s1 |
| InChIKey | YESRGCZCFGWJCH-UNEACQKKSA-N |
| XLogP | 2.14 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|