C39H48O11 — CID 102420194
[(2R,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methanol (PubChem CID 102420194) has the molecular formula C39H48O11 and a molecular weight of 692.80 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 102420194 |
| Molecular Formula | C39H48O11 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methanol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COC1O[C@H](CO)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]1OCc1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C39H48O11/c1-38(2)47-31-29(46-37-35(33(31)48-38)49-39(3,4)50-37)24-44-36-34(43-23-27-18-12-7-13-19-27)32(42-22-26-16-10-6-11-17-26)30(28(20-40)45-36)41-21-25-14-8-5-9-15-25/h5-19,28-37,40H,20-24H2,1-4H3/t28-,29-,30+,31+,32+,33+,34-,35-,36?,37-/m1/s1 |
| InChIKey | KLPZUUQPOGPUJV-VHCOPUAZSA-N |
| XLogP | 4.87 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |