C26H38O15 — CID 134972340
[(3R,6R)-3,4,5-triacetyloxy-6-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 134972340) has the molecular formula C26H38O15 and a molecular weight of 590.58 g/mol. Its IUPAC name is [(3R,6R)-3,4,5-triacetyloxy-6-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,4,5-triacetyloxy-6-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134972340 |
| Molecular Formula | C26H38O15 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [(3R,6R)-3,4,5-triacetyloxy-6-[[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OCC2O[C@@H]3OC(C)(C)OC3C3OC(C)(C)O[C@@H]23)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O15/c1-11(27)31-9-15-17(33-12(2)28)19(34-13(3)29)21(35-14(4)30)23(36-15)32-10-16-18-20(39-25(5,6)38-18)22-24(37-16)41-26(7,8)40-22/h15-24H,9-10H2,1-8H3/t15?,16?,17-,18+,19?,20?,21?,22?,23-,24-/m1/s1 |
| InChIKey | KBXNZSMACDLJNP-AFXDZLBJSA-N |
| XLogP | 0.48 |
| TPSA | 169.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|