C26H39NO14 — CID 11103896
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 11103896) has the molecular formula C26H39NO14 and a molecular weight of 589.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11103896 |
| Molecular Formula | C26H39NO14 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H39NO14/c1-11(28)27-17-20(35-14(4)31)18(34-13(3)30)15(9-32-12(2)29)36-23(17)33-10-16-19-21(39-25(5,6)38-19)22-24(37-16)41-26(7,8)40-22/h15-24H,9-10H2,1-8H3,(H,27,28)/t15-,16-,17-,18-,19+,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | ZHWYCFFIYYYDMI-KJZBTVIPSA-N |
| XLogP | 0.06 |
| TPSA | 172.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|