C32H47NO14 — CID 99657744
CID 99657744 (PubChem CID 99657744) has the molecular formula C32H47NO14 and a molecular weight of 669.72 g/mol.
| Compound Name | CID 99657744 |
|---|---|
| PubChem CID | 99657744 |
| Molecular Formula | C32H47NO14 |
| Molecular Weight | 669.72 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC[C@H]2O[C@@H]3OC4(CCCCC4)O[C@@H]3[C@H]3OC4(CCCCC4)O[C@@H]32)O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H47NO14/c1-17(34)33-23-26(41-20(4)37)24(40-19(3)36)21(15-38-18(2)35)42-29(23)39-16-22-25-27(45-31(44-25)11-7-5-8-12-31)28-30(43-22)47-32(46-28)13-9-6-10-14-32/h21-30H,5-16H2,1-4H3,(H,33,34)/t21-,22+,23-,24+,25+,26-,27-,28+,29-,30+/m0/s1 |
| InChIKey | KQPACFUEGAAHNG-XFLKXUIRSA-N |
| XLogP | 1.90 |
| TPSA | 172.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|