C26H38O14S2 — CID 102046025
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]oxan-2-yl]methyl acetate (PubChem CID 102046025) has the molecular formula C26H38O14S2 and a molecular weight of 638.71 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102046025 |
| Molecular Formula | C26H38O14S2 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyldisulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SSC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O14S2/c1-11(27)31-9-15-17(32-12(2)28)19(33-13(3)29)22(34-14(4)30)24(36-15)42-41-10-16-18-20(38-25(5,6)37-18)21-23(35-16)40-26(7,8)39-21/h15-24H,9-10H2,1-8H3/t15-,16-,17+,18+,19+,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | PLJBEPUWGMAIDC-FEXNERQYSA-N |
| XLogP | 1.85 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|