C22H24O9 — CID 74665510
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-oxochromene-3-carboxylate (PubChem CID 74665510) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 74665510 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-oxochromene-3-carboxylate |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3C2OC(=O)c2cc3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C22H24O9/c1-21(2)25-10-14(29-21)15-16(17-20(28-15)31-22(3,4)30-17)27-19(24)12-9-11-7-5-6-8-13(11)26-18(12)23/h5-9,14-17,20H,10H2,1-4H3 |
| InChIKey | VVUHSBYOSFUCFY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|