C40H42O10 — CID 102310963
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 3,4,5-tris(phenylmethoxy)benzoate (PubChem CID 102310963) has the molecular formula C40H42O10 and a molecular weight of 682.77 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 3,4,5-tris(phenylmethoxy)benzoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 3,4,5-tris(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 102310963 |
| Molecular Formula | C40H42O10 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 3,4,5-tris(phenylmethoxy)benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OC(=O)c3cc(OCc4ccccc4)c(OCc4ccccc4)c(OCc4ccccc4)c3)[C@H]2O1 |
| InChI | InChI=1S/C40H42O10/c1-39(2)45-25-32(48-39)34-35(36-38(47-34)50-40(3,4)49-36)46-37(41)29-20-30(42-22-26-14-8-5-9-15-26)33(44-24-28-18-12-7-13-19-28)31(21-29)43-23-27-16-10-6-11-17-27/h5-21,32,34-36,38H,22-25H2,1-4H3/t32-,34-,35+,36-,38-/m1/s1 |
| InChIKey | BZKLJKJDFGBAKW-FUUDJPOPSA-N |
| XLogP | 6.98 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |