C24H33FO7 — CID 162418021
[(3aS,5S,6R,6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-fluoro-6-phenylhexanoate (PubChem CID 162418021) has the molecular formula C24H33FO7 and a molecular weight of 452.52 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-fluoro-6-phenylhexanoate.
| Compound Name | [(3aS,5S,6R,6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-fluoro-6-phenylhexanoate |
|---|---|
| PubChem CID | 162418021 |
| Molecular Formula | C24H33FO7 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [(3aS,5S,6R,6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 5-fluoro-6-phenylhexanoate |
| SMILES | CC1(C)OCC([C@@H]2O[C@H]3OC(C)(C)O[C@H]3[C@@H]2OC(=O)CCCC(F)Cc2ccccc2)O1 |
| InChI | InChI=1S/C24H33FO7/c1-23(2)27-14-17(30-23)19-20(21-22(29-19)32-24(3,4)31-21)28-18(26)12-8-11-16(25)13-15-9-6-5-7-10-15/h5-7,9-10,16-17,19-22H,8,11-14H2,1-4H3/t16?,17?,19-,20+,21-,22-/m0/s1 |
| InChIKey | ZFJKIHFNSUNDGO-WYMYEUOHSA-N |
| XLogP | 3.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |