C25H31F3O7 — CID 100930378
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-benzyl-2-methyl-3-(trifluoromethyl)but-3-enoate (PubChem CID 100930378) has the molecular formula C25H31F3O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-benzyl-2-methyl-3-(trifluoromethyl)but-3-enoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-benzyl-2-methyl-3-(trifluoromethyl)but-3-enoate |
|---|---|
| PubChem CID | 100930378 |
| Molecular Formula | C25H31F3O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-benzyl-2-methyl-3-(trifluoromethyl)but-3-enoate |
| SMILES | C=C(C(F)(F)F)C(C)(Cc1ccccc1)C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H31F3O7/c1-14(25(26,27)28)24(6,12-15-10-8-7-9-11-15)21(29)32-18-17(16-13-30-22(2,3)33-16)31-20-19(18)34-23(4,5)35-20/h7-11,16-20H,1,12-13H2,2-6H3/t16-,17-,18+,19-,20-,24?/m1/s1 |
| InChIKey | HLVXQNPYZPZXAM-ONWGCWJQSA-N |
| XLogP | 4.29 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|