C21H32O9 — CID 10274162
7-O-[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-ethenyl heptanedioate (PubChem CID 10274162) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is 7-O-[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-ethenyl heptanedioate.
| Compound Name | 7-O-[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-ethenyl heptanedioate |
|---|---|
| PubChem CID | 10274162 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 7-O-[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-ethenyl heptanedioate |
| SMILES | C=COC(=O)CCCCCC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C21H32O9/c1-6-24-14(22)10-8-7-9-11-15(23)26-17-16(13-12-25-20(2,3)28-13)27-19-18(17)29-21(4,5)30-19/h6,13,16-19H,1,7-12H2,2-5H3/t13?,16-,17+,18-,19-/m1/s1 |
| InChIKey | YQITUIBPJYWATI-SMXSEESUSA-N |
| XLogP | 2.56 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|