C22H35NO8 — CID 102085887
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 102085887) has the molecular formula C22H35NO8 and a molecular weight of 441.52 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 6-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 6-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 102085887 |
| Molecular Formula | C22H35NO8 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCCCC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H35NO8/c1-13(2)19(25)23-11-9-7-8-10-15(24)27-17-16(14-12-26-21(3,4)29-14)28-20-18(17)30-22(5,6)31-20/h14,16-18,20H,1,7-12H2,2-6H3,(H,23,25)/t14-,16-,17+,18-,20-/m1/s1 |
| InChIKey | HRPYMWXJWLIWCT-UVNCQSPWSA-N |
| XLogP | 2.18 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|