C18H23NO4 — CID 904969
[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 904969) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 904969 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OC[C@H]1CCCN2CCCC[C@H]12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H23NO4/c20-18(13-6-7-16-17(10-13)23-12-22-16)21-11-14-4-3-9-19-8-2-1-5-15(14)19/h6-7,10,14-15H,1-5,8-9,11-12H2/t14-,15-/m1/s1 |
| InChIKey | DUKKSZLDZDKYFL-HUUCEWRRSA-N |
| XLogP | 2.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |