C17H21Cl2NO2 — CID 11905182
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2,4-dichlorobenzoate (PubChem CID 11905182) has the molecular formula C17H21Cl2NO2 and a molecular weight of 342.27 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2,4-dichlorobenzoate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 11905182 |
| Molecular Formula | C17H21Cl2NO2 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2,4-dichlorobenzoate |
| SMILES | O=C(OC[C@@H]1CCCN2CCCC[C@H]12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2NO2/c18-13-6-7-14(15(19)10-13)17(21)22-11-12-4-3-9-20-8-2-1-5-16(12)20/h6-7,10,12,16H,1-5,8-9,11H2/t12-,16+/m0/s1 |
| InChIKey | CCLSTXKOTBCBIO-BLLLJJGKSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |