C17H22Cl2N2O5S — CID 3463214
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-(2,3-dichlorophenoxy)sulfonylcarbamate (PubChem CID 3463214) has the molecular formula C17H22Cl2N2O5S and a molecular weight of 437.35 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-(2,3-dichlorophenoxy)sulfonylcarbamate.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-(2,3-dichlorophenoxy)sulfonylcarbamate |
|---|---|
| PubChem CID | 3463214 |
| Molecular Formula | C17H22Cl2N2O5S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-(2,3-dichlorophenoxy)sulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)Oc1cccc(Cl)c1Cl)OCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C17H22Cl2N2O5S/c18-13-6-3-8-15(16(13)19)26-27(23,24)20-17(22)25-11-12-5-4-10-21-9-2-1-7-14(12)21/h3,6,8,12,14H,1-2,4-5,7,9-11H2,(H,20,22) |
| InChIKey | RYOUXWVIBJZOIC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |