C20H28N2O2 — CID 56883556
2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-N-cyclopropylbenzamide (PubChem CID 56883556) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-N-cyclopropylbenzamide.
| Compound Name | 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 56883556 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccccc1OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C20H28N2O2/c23-20(21-16-10-11-16)17-7-1-2-9-19(17)24-14-15-6-5-13-22-12-4-3-8-18(15)22/h1-2,7,9,15-16,18H,3-6,8,10-14H2,(H,21,23)/t15-,18+/m0/s1 |
| InChIKey | CDMVOUABEYOPIL-MAUKXSAKSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |