C10H19NO4S — CID 7061084
[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl hydrogen sulfate (PubChem CID 7061084) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl hydrogen sulfate.
| Compound Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 7061084 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@@H]1CCCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C10H19NO4S/c12-16(13,14)15-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10H,1-8H2,(H,12,13,14)/t9-,10-/m0/s1 |
| InChIKey | CNAMMIWTQITTHV-UWVGGRQHSA-N |
| XLogP | 1.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|