C16H28BrNO2 — CID 10020488
(5-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-methylprop-2-enoate bromide (PubChem CID 10020488) has the molecular formula C16H28BrNO2 and a molecular weight of 346.31 g/mol. Its IUPAC name is (5-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-methylprop-2-enoate bromide.
| Compound Name | (5-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-methylprop-2-enoate bromide |
|---|---|
| PubChem CID | 10020488 |
| Molecular Formula | C16H28BrNO2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (5-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl 2-methylprop-2-enoate bromide |
| SMILES | C=C(C)C(=O)OCC1CCC[N+]2(CC)CCCCC12.[Br-] |
| InChI | InChI=1S/C16H28NO2.BrH/c1-4-17-10-6-5-9-15(17)14(8-7-11-17)12-19-16(18)13(2)3;/h14-15H,2,4-12H2,1,3H3;1H/q+1;/p-1 |
| InChIKey | GKCTZCHAELGUHN-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|