C11H20O4 — CID 67764408
ethanol;oxolan-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 67764408) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethanol;oxolan-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | ethanol;oxolan-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67764408 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethanol;oxolan-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCCO1.CCO |
| InChI | InChI=1S/C9H14O3.C2H6O/c1-7(2)9(10)12-6-8-4-3-5-11-8;1-2-3/h8H,1,3-6H2,2H3;3H,2H2,1H3 |
| InChIKey | ZFVUGDRXTYHRAA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|