C23H40O5 — CID 70019824
8-methylnonyl 2-methylprop-2-enoate;oxolan-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 70019824) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 8-methylnonyl 2-methylprop-2-enoate;oxolan-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 8-methylnonyl 2-methylprop-2-enoate;oxolan-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70019824 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 8-methylnonyl 2-methylprop-2-enoate;oxolan-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCCO1.C=C(C)C(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C14H26O2.C9H14O3/c1-12(2)10-8-6-5-7-9-11-16-14(15)13(3)4;1-7(2)9(10)12-6-8-4-3-5-11-8/h12H,3,5-11H2,1-2,4H3;8H,1,3-6H2,2H3 |
| InChIKey | BRLOYTLGNGJFRH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|