C21H38O5 — CID 175474379
8-methylnonyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxetane (PubChem CID 175474379) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is 8-methylnonyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxetane.
| Compound Name | 8-methylnonyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxetane |
|---|---|
| PubChem CID | 175474379 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 8-methylnonyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;oxetane |
| SMILES | C1COC1.C=C(C)C(=O)O.C=C(C)C(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C14H26O2.C4H6O2.C3H6O/c1-12(2)10-8-6-5-7-9-11-16-14(15)13(3)4;1-3(2)4(5)6;1-2-4-3-1/h12H,3,5-11H2,1-2,4H3;1H2,2H3,(H,5,6);1-3H2 |
| InChIKey | TZESMUDVQOZALF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|