About 3-cyclododecylbutan-2-ol
3-cyclododecylbutan-2-ol (PubChem CID 10444334) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 3-cyclododecylbutan-2-ol.
Molecular Properties
| Compound Name | 3-cyclododecylbutan-2-ol |
| PubChem CID | 10444334 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 3-cyclododecylbutan-2-ol |
| SMILES | CC(O)C(C)C1CCCCCCCCCCC1 |
| InChI | InChI=1S/C16H32O/c1-14(15(2)17)16-12-10-8-6-4-3-5-7-9-11-13-16/h14-17H,3-13H2,1-2H3 |
| InChIKey | LFTJDPRTLFJVFY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclododecylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclododecylbutan-2-ol?
The IUPAC name of 3-cyclododecylbutan-2-ol (CID 10444334) is 3-cyclododecylbutan-2-ol.
What is the SMILES notation for 3-cyclododecylbutan-2-ol?
The canonical SMILES for 3-cyclododecylbutan-2-ol is CC(O)C(C)C1CCCCCCCCCCC1.
What is the InChIKey of 3-cyclododecylbutan-2-ol?
The InChIKey is LFTJDPRTLFJVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O/c1-14(15(2)17)16-12-10-8-6-4-3-5-7-9-11-13-16/h14-17H,3-13H2,1-2H3.
What are the key properties of 3-cyclododecylbutan-2-ol?
3-cyclododecylbutan-2-ol has a molecular weight of 240.43 g/mol, XLogP of 4.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclododecylbutan-2-ol is sourced from PubChem (CID 10444334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).