C10H20O2 — CID 103452573
1-cycloheptylpropane-1,2-diol (PubChem CID 103452573) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-cycloheptylpropane-1,2-diol.
| Compound Name | 1-cycloheptylpropane-1,2-diol |
|---|---|
| PubChem CID | 103452573 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 1-cycloheptylpropane-1,2-diol |
| SMILES | CC(O)C(O)C1CCCCCC1 |
| InChI | InChI=1S/C10H20O2/c1-8(11)10(12)9-6-4-2-3-5-7-9/h8-12H,2-7H2,1H3 |
| InChIKey | JLZCQYXVEVQMHD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |