About 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine
1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine (PubChem CID 145336371) has the molecular formula C19H41NO
and a molecular weight of 299.54 g/mol. Its IUPAC name is 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine.
Molecular Properties
| Compound Name | 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine |
| PubChem CID | 145336371 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine |
| SMILES | CC.CC(C)C(O)C1CCCC1.CC(C)NC1CCCC1 |
| InChI | InChI=1S/C9H18O.C8H17N.C2H6/c1-7(2)9(10)8-5-3-4-6-8;1-7(2)9-8-5-3-4-6-8;1-2/h7-10H,3-6H2,1-2H3;7-9H,3-6H2,1-2H3;1-2H3 |
| InChIKey | RYRMJXYTIDMJTF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine?
The IUPAC name of 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine (CID 145336371) is 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine.
What is the SMILES notation for 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine?
The canonical SMILES for 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine is CC.CC(C)C(O)C1CCCC1.CC(C)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine?
The InChIKey is RYRMJXYTIDMJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C8H17N.C2H6/c1-7(2)9(10)8-5-3-4-6-8;1-7(2)9-8-5-3-4-6-8;1-2/h7-10H,3-6H2,1-2H3;7-9H,3-6H2,1-2H3;1-2H3.
What are the key properties of 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine?
1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine has a molecular weight of 299.54 g/mol, XLogP of 5.15, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-methylpropan-1-ol;ethane;N-propan-2-ylcyclopentanamine is sourced from PubChem (CID 145336371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).