About ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen
ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen (PubChem CID 177228203) has the molecular formula C12H32N2
and a molecular weight of 204.40 g/mol. Its IUPAC name is ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen |
| PubChem CID | 177228203 |
| Molecular Formula | C12H32N2 |
| Molecular Weight | 204.40 g/mol |
| Exact Mass | 204.26 |
| IUPAC Name | ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen |
| SMILES | CC.CNC1CCC(NC(C)C)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C10H22N2.C2H6.2H2/c1-8(2)12-10-6-4-9(11-3)5-7-10;1-2;;/h8-12H,4-7H2,1-3H3;1-2H3;2*1H |
| InChIKey | STPSVFBBCYFWSM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen?
The IUPAC name of ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen (CID 177228203) is ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen.
What is the SMILES notation for ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen?
The canonical SMILES for ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen is CC.CNC1CCC(NC(C)C)CC1.[H][H].[H][H].
What is the InChIKey of ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen?
The InChIKey is STPSVFBBCYFWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.C2H6.2H2/c1-8(2)12-10-6-4-9(11-3)5-7-10;1-2;;/h8-12H,4-7H2,1-3H3;1-2H3;2*1H.
What are the key properties of ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen?
ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen has a molecular weight of 204.40 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine;molecular hydrogen is sourced from PubChem (CID 177228203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).