C17H26O2 — CID 69422386
2-cyclopentyl-4-methyl-4-phenylpentane-1,1-diol (PubChem CID 69422386) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-cyclopentyl-4-methyl-4-phenylpentane-1,1-diol.
| Compound Name | 2-cyclopentyl-4-methyl-4-phenylpentane-1,1-diol |
|---|---|
| PubChem CID | 69422386 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-cyclopentyl-4-methyl-4-phenylpentane-1,1-diol |
| SMILES | CC(C)(CC(C(O)O)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H26O2/c1-17(2,14-10-4-3-5-11-14)12-15(16(18)19)13-8-6-7-9-13/h3-5,10-11,13,15-16,18-19H,6-9,12H2,1-2H3 |
| InChIKey | MRDDKYZTNIDJBX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|