C25H34O — CID 150218147
2,4,6,8-tetramethyl-2,8-diphenylnonan-5-one (PubChem CID 150218147) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,8-diphenylnonan-5-one.
| Compound Name | 2,4,6,8-tetramethyl-2,8-diphenylnonan-5-one |
|---|---|
| PubChem CID | 150218147 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,8-diphenylnonan-5-one |
| SMILES | CC(CC(C)(C)c1ccccc1)C(=O)C(C)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H34O/c1-19(17-24(3,4)21-13-9-7-10-14-21)23(26)20(2)18-25(5,6)22-15-11-8-12-16-22/h7-16,19-20H,17-18H2,1-6H3 |
| InChIKey | FSXLOHQISRZTMF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |