C13H21N — CID 42077724
(2R)-N,4-dimethyl-4-phenylpentan-2-amine (PubChem CID 42077724) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2R)-N,4-dimethyl-4-phenylpentan-2-amine.
| Compound Name | (2R)-N,4-dimethyl-4-phenylpentan-2-amine |
|---|---|
| PubChem CID | 42077724 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2R)-N,4-dimethyl-4-phenylpentan-2-amine |
| SMILES | CN[C@H](C)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H21N/c1-11(14-4)10-13(2,3)12-8-6-5-7-9-12/h5-9,11,14H,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | FGDCHRPBLHOPJC-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |