C18H21Cl2N — CID 65468772
2,6-dichloro-N-(4-methyl-4-phenylpentan-2-yl)aniline (PubChem CID 65468772) has the molecular formula C18H21Cl2N and a molecular weight of 322.28 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-methyl-4-phenylpentan-2-yl)aniline.
| Compound Name | 2,6-dichloro-N-(4-methyl-4-phenylpentan-2-yl)aniline |
|---|---|
| PubChem CID | 65468772 |
| Molecular Formula | C18H21Cl2N |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2,6-dichloro-N-(4-methyl-4-phenylpentan-2-yl)aniline |
| SMILES | CC(CC(C)(C)c1ccccc1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H21Cl2N/c1-13(21-17-15(19)10-7-11-16(17)20)12-18(2,3)14-8-5-4-6-9-14/h4-11,13,21H,12H2,1-3H3 |
| InChIKey | IRCUHZUZELOCRG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |