C16H25NO2 — CID 43786736
methyl (2S)-2-[(4-methyl-4-phenylpentan-2-yl)amino]propanoate (PubChem CID 43786736) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is methyl (2S)-2-[(4-methyl-4-phenylpentan-2-yl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(4-methyl-4-phenylpentan-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 43786736 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | methyl (2S)-2-[(4-methyl-4-phenylpentan-2-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(C)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2/c1-12(17-13(2)15(18)19-5)11-16(3,4)14-9-7-6-8-10-14/h6-10,12-13,17H,11H2,1-5H3/t12?,13-/m0/s1 |
| InChIKey | YXUDQQNLKADFKO-ABLWVSNPSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |