C17H29ClN2O2 — CID 120590624
4-amino-3-methoxy-N-(4-methyl-4-phenylpentan-2-yl)butanamide;hydrochloride (PubChem CID 120590624) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(4-methyl-4-phenylpentan-2-yl)butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-(4-methyl-4-phenylpentan-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120590624 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-amino-3-methoxy-N-(4-methyl-4-phenylpentan-2-yl)butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NC(C)CC(C)(C)c1ccccc1.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-13(19-16(20)10-15(12-18)21-4)11-17(2,3)14-8-6-5-7-9-14;/h5-9,13,15H,10-12,18H2,1-4H3,(H,19,20);1H |
| InChIKey | ADVUDSAYTROYCD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |