C16H24F2O3S — CID 19804768
1-(benzenesulfonyl)-1,1-difluoro-3,3,5,5-tetramethylhexan-2-ol (PubChem CID 19804768) has the molecular formula C16H24F2O3S and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluoro-3,3,5,5-tetramethylhexan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1-difluoro-3,3,5,5-tetramethylhexan-2-ol |
|---|---|
| PubChem CID | 19804768 |
| Molecular Formula | C16H24F2O3S |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluoro-3,3,5,5-tetramethylhexan-2-ol |
| SMILES | CC(C)(C)CC(C)(C)C(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24F2O3S/c1-14(2,3)11-15(4,5)13(19)16(17,18)22(20,21)12-9-7-6-8-10-12/h6-10,13,19H,11H2,1-5H3 |
| InChIKey | HBFNPEVQTADKPL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |