C15H20F5NO3S2 — CID 174220145
[[(2S)-1-(benzenesulfonyl)-1,1,5,5,5-pentafluoropentan-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174220145) has the molecular formula C15H20F5NO3S2 and a molecular weight of 421.45 g/mol. Its IUPAC name is [[(2S)-1-(benzenesulfonyl)-1,1,5,5,5-pentafluoropentan-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2S)-1-(benzenesulfonyl)-1,1,5,5,5-pentafluoropentan-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174220145 |
| Molecular Formula | C15H20F5NO3S2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [[(2S)-1-(benzenesulfonyl)-1,1,5,5,5-pentafluoropentan-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](CCC(F)(F)F)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20F5NO3S2/c1-13(2,3)25(22)21-12(9-10-14(16,17)18)15(19,20)26(23,24)11-7-5-4-6-8-11/h4-8,12,21H,9-10H2,1-3H3/t12-,25?/m0/s1 |
| InChIKey | BEPVYCUTUYRJCP-UNHBDAOFSA-N |
| XLogP | 3.82 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|