C15H14F2O2S — CID 11335440
[3-(benzenesulfonyl)-3,3-difluoropropyl]benzene (PubChem CID 11335440) has the molecular formula C15H14F2O2S and a molecular weight of 296.34 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-3,3-difluoropropyl]benzene.
| Compound Name | [3-(benzenesulfonyl)-3,3-difluoropropyl]benzene |
|---|---|
| PubChem CID | 11335440 |
| Molecular Formula | C15H14F2O2S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | [3-(benzenesulfonyl)-3,3-difluoropropyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C15H14F2O2S/c16-15(17,12-11-13-7-3-1-4-8-13)20(18,19)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | RPLGWHWMYUCAKL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |