C20H23F3O2S — CID 71474831
[4-(benzenesulfonyl)-4-(trifluoromethyl)heptyl]benzene (PubChem CID 71474831) has the molecular formula C20H23F3O2S and a molecular weight of 384.46 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-4-(trifluoromethyl)heptyl]benzene.
| Compound Name | [4-(benzenesulfonyl)-4-(trifluoromethyl)heptyl]benzene |
|---|---|
| PubChem CID | 71474831 |
| Molecular Formula | C20H23F3O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [4-(benzenesulfonyl)-4-(trifluoromethyl)heptyl]benzene |
| SMILES | CCCC(CCCc1ccccc1)(C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23F3O2S/c1-2-15-19(20(21,22)23,16-9-12-17-10-5-3-6-11-17)26(24,25)18-13-7-4-8-14-18/h3-8,10-11,13-14H,2,9,12,15-16H2,1H3 |
| InChIKey | NKMXPNGYKRMIPF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |