C13H16F2O2S — CID 16744218
[(E)-1,1-difluorohept-2-enyl]sulfonylbenzene (PubChem CID 16744218) has the molecular formula C13H16F2O2S and a molecular weight of 274.33 g/mol. Its IUPAC name is [(E)-1,1-difluorohept-2-enyl]sulfonylbenzene.
| Compound Name | [(E)-1,1-difluorohept-2-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 16744218 |
| Molecular Formula | C13H16F2O2S |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [(E)-1,1-difluorohept-2-enyl]sulfonylbenzene |
| SMILES | CCCC/C=C/C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16F2O2S/c1-2-3-4-8-11-13(14,15)18(16,17)12-9-6-5-7-10-12/h5-11H,2-4H2,1H3/b11-8+ |
| InChIKey | SSRIOEVCUZPGNP-DHZHZOJOSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|