C13H17F2IO2S — CID 16744044
(1,1-difluoro-3-iodoheptyl)sulfonylbenzene (PubChem CID 16744044) has the molecular formula C13H17F2IO2S and a molecular weight of 402.24 g/mol. Its IUPAC name is (1,1-difluoro-3-iodoheptyl)sulfonylbenzene.
| Compound Name | (1,1-difluoro-3-iodoheptyl)sulfonylbenzene |
|---|---|
| PubChem CID | 16744044 |
| Molecular Formula | C13H17F2IO2S |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | (1,1-difluoro-3-iodoheptyl)sulfonylbenzene |
| SMILES | CCCCC(I)CC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17F2IO2S/c1-2-3-7-11(16)10-13(14,15)19(17,18)12-8-5-4-6-9-12/h4-6,8-9,11H,2-3,7,10H2,1H3 |
| InChIKey | DUAKQPWQLAGXPZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|