About [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane
[(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane (PubChem CID 132548452) has the molecular formula C15H20F3NOS
and a molecular weight of 319.39 g/mol. Its IUPAC name is [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane.
Molecular Properties
| Compound Name | [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane |
| PubChem CID | 132548452 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane |
| SMILES | CCCCCC/C=C/N=S(=O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H20F3NOS/c1-2-3-4-5-6-10-13-19-21(20,15(16,17)18)14-11-8-7-9-12-14/h7-13H,2-6H2,1H3/b13-10+ |
| InChIKey | CKAYOVOEYWNCFF-JLHYYAGUSA-N |
| XLogP | 5.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane?
The IUPAC name of [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane (CID 132548452) is [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane.
What is the SMILES notation for [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane?
The canonical SMILES for [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane is CCCCCC/C=C/N=S(=O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane?
The InChIKey is CKAYOVOEYWNCFF-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H20F3NOS/c1-2-3-4-5-6-10-13-19-21(20,15(16,17)18)14-11-8-7-9-12-14/h7-13H,2-6H2,1H3/b13-10+.
What are the key properties of [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane?
[(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane has a molecular weight of 319.39 g/mol, XLogP of 5.52, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-oct-1-enyl]imino-oxo-phenyl-(trifluoromethyl)-λ6-sulfane is sourced from PubChem (CID 132548452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).