About [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate
[triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 134978514) has the molecular formula C30H36F3O3PS
and a molecular weight of 564.65 g/mol. Its IUPAC name is [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate |
| PubChem CID | 134978514 |
| Molecular Formula | C30H36F3O3PS |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | CCCCCCCC/C=C/CP(OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36F3O3PS/c1-2-3-4-5-6-7-8-9-19-26-37(27-20-13-10-14-21-27,28-22-15-11-16-23-28,29-24-17-12-18-25-29)36-38(34,35)30(31,32)33/h9-25H,2-8,26H2,1H3/b19-9+ |
| InChIKey | YWZZEJZXTNNVDE-DJKKODMXSA-N |
| XLogP | 7.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate?
The IUPAC name of [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate (CID 134978514) is [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate.
What is the SMILES notation for [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate?
The canonical SMILES for [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate is CCCCCCCC/C=C/CP(OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate?
The InChIKey is YWZZEJZXTNNVDE-DJKKODMXSA-N. The full InChI is InChI=1S/C30H36F3O3PS/c1-2-3-4-5-6-7-8-9-19-26-37(27-20-13-10-14-21-27,28-22-15-11-16-23-28,29-24-17-12-18-25-29)36-38(34,35)30(31,32)33/h9-25H,2-8,26H2,1H3/b19-9+.
What are the key properties of [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate?
[triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate has a molecular weight of 564.65 g/mol, XLogP of 7.60, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [triphenyl-[(E)-undec-2-enyl]-λ5-phosphanyl] trifluoromethanesulfonate is sourced from PubChem (CID 134978514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).