C30H28F3O3PS — CID 134977072
[[(Z)-4-(4-methylphenyl)but-3-enyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 134977072) has the molecular formula C30H28F3O3PS and a molecular weight of 556.59 g/mol. Its IUPAC name is [[(Z)-4-(4-methylphenyl)but-3-enyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [[(Z)-4-(4-methylphenyl)but-3-enyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134977072 |
| Molecular Formula | C30H28F3O3PS |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | [[(Z)-4-(4-methylphenyl)but-3-enyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(/C=C\CCP(OS(=O)(=O)C(F)(F)F)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28F3O3PS/c1-25-20-22-26(23-21-25)13-11-12-24-37(27-14-5-2-6-15-27,28-16-7-3-8-17-28,29-18-9-4-10-19-29)36-38(34,35)30(31,32)33/h2-11,13-23H,12,24H2,1H3/b13-11- |
| InChIKey | QTZBFBBGCHXLAI-QBFSEMIESA-N |
| XLogP | 6.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|