C38H30F6O7P2S2 — CID 12027763
[triphenyl-[triphenyl(trifluoromethylsulfonyloxy)-λ5-phosphanyl]oxy-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 12027763) has the molecular formula C38H30F6O7P2S2 and a molecular weight of 838.72 g/mol. Its IUPAC name is [triphenyl-[triphenyl(trifluoromethylsulfonyloxy)-λ5-phosphanyl]oxy-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [triphenyl-[triphenyl(trifluoromethylsulfonyloxy)-λ5-phosphanyl]oxy-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12027763 |
| Molecular Formula | C38H30F6O7P2S2 |
| Molecular Weight | 838.72 g/mol |
| Exact Mass | 838.08 |
| IUPAC Name | [triphenyl-[triphenyl(trifluoromethylsulfonyloxy)-λ5-phosphanyl]oxy-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OP(OP(OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H30F6O7P2S2/c39-37(40,41)54(45,46)50-52(31-19-7-1-8-20-31,32-21-9-2-10-22-32,33-23-11-3-12-24-33)49-53(34-25-13-4-14-26-34,35-27-15-5-16-28-35,36-29-17-6-18-30-36)51-55(47,48)38(42,43)44/h1-30H |
| InChIKey | ZDGGLMFDFAIIGI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|