C25H30F3O4PSSi — CID 134976930
[triphenyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 134976930) has the molecular formula C25H30F3O4PSSi and a molecular weight of 542.63 g/mol. Its IUPAC name is [triphenyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [triphenyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134976930 |
| Molecular Formula | C25H30F3O4PSSi |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [triphenyl(1-trimethylsilyloxypropyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | CCC(O[Si](C)(C)C)P(OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30F3O4PSSi/c1-5-24(31-35(2,3)4)33(21-15-9-6-10-16-21,22-17-11-7-12-18-22,23-19-13-8-14-20-23)32-34(29,30)25(26,27)28/h6-20,24H,5H2,1-4H3 |
| InChIKey | FGXJIWYMQXTLAL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|